ChemNet > CAS > 17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
| product Name |
(2R,5R)-(-)-2,5-Hexanediol |
| CAS No |
17299-07-9 |
| Synonyms |
(2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
| Molecular Formula |
C6H14O2 |
| Molecular Weight |
118.1742 |
| InChI |
InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| Molecular Structure |
|
| Density |
0.958g/cm3 |
| Melting point |
50-53℃ |
| Boiling point |
213.4°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
101.7°C |
| Vapour Pressur |
0.0364mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
