ChemNet > CAS > 1732-08-7 Dimethyl pimelate
1732-08-7 Dimethyl pimelate
| product Name |
Dimethyl pimelate |
| CAS No |
1732-08-7 |
| Synonyms |
Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| Molecular Formula |
C9H16O4 |
| Molecular Weight |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| EINECS |
217-057-4 |
| Molecular Structure |
|
| Density |
1.022g/cm3 |
| Boiling point |
250.3°C at 760 mmHg |
| Refractive index |
1.427 |
| Flash point |
105.4°C |
| Vapour Pressur |
0.0219mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
