ChemNet > CAS > 173282-60-5 6-morpholinonicotinaldehyde
173282-60-5 6-morpholinonicotinaldehyde
| product Name |
6-morpholinonicotinaldehyde |
| CAS No |
173282-60-5 |
| Synonyms |
6-Morpholin-4-yl-pyridine-3-carbaldehyde |
| Molecular Formula |
C10H12N2O2 |
| Molecular Weight |
192.2145 |
| InChI |
InChI=1/C10H12N2O2/c13-8-9-1-2-10(11-7-9)12-3-5-14-6-4-12/h1-2,7-8H,3-6H2 |
| Molecular Structure |
|
| Density |
1.219g/cm3 |
| Melting point |
84℃ |
| Boiling point |
395.8°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
193.2°C |
| Vapour Pressur |
1.79E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
