ChemNet > CAS > 1742-95-6 4-Amino-1,8-naphthalimide
1742-95-6 4-Amino-1,8-naphthalimide
| product Name |
4-Amino-1,8-naphthalimide |
| CAS No |
1742-95-6 |
| Molecular Formula |
C12H8N2O2 |
| Molecular Weight |
212.2041 |
| InChI |
InChI=1/C12H8N2O2/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(15)14-12(8)16/h1-5H,13H2,(H,14,15,16) |
| EINECS |
217-110-1 |
| Molecular Structure |
|
| Density |
1.474g/cm3 |
| Melting point |
360℃ |
| Boiling point |
544.1°C at 760 mmHg |
| Refractive index |
1.764 |
| Flash point |
282.8°C |
| Vapour Pressur |
6.75E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
