ChemNet > CAS > 175135-73-6 2,5-difluorophenylhydrazine hydrochloride
175135-73-6 2,5-difluorophenylhydrazine hydrochloride
| product Name |
2,5-difluorophenylhydrazine hydrochloride |
| CAS No |
175135-73-6 |
| Synonyms |
1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane; (2,5-difluorophenyl)diazanium chloride |
| Molecular Formula |
C6H7ClF2N2 |
| Molecular Weight |
180.583 |
| InChI |
InChI=1/C6H6F2N2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H |
| EINECS |
218-868-6 |
| Molecular Structure |
|
| Melting point |
210℃ |
| Boiling point |
189.5°C at 760 mmHg |
| Flash point |
68.4°C |
| Vapour Pressur |
0.567mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
