ChemNet > CAS > 175203-47-1 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
175203-47-1 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
| product Name |
3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
| CAS No |
175203-47-1 |
| Synonyms |
3-benzyl-1-(1-methylethyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
| Molecular Formula |
C15H15N3O2 |
| Molecular Weight |
269.2985 |
| InChI |
InChI=1/C15H15N3O2/c1-11(2)17-10-13(8-16)14(19)18(15(17)20)9-12-6-4-3-5-7-12/h3-7,10-11H,9H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Melting point |
151℃ |
| Boiling point |
399.1°C at 760 mmHg |
| Refractive index |
1.609 |
| Flash point |
195.1°C |
| Vapour Pressur |
1.41E-06mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
