ChemNet > CAS > 175204-06-5 2-Fluoro-6-phenoxybenzonitrile
175204-06-5 2-Fluoro-6-phenoxybenzonitrile
| product Name |
2-Fluoro-6-phenoxybenzonitrile |
| CAS No |
175204-06-5 |
| Synonyms |
2-Fluoro-6-phenyloxybenzonitrile |
| Molecular Formula |
C13H8FNO |
| Molecular Weight |
213.2071 |
| InChI |
InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Melting point |
90-93℃ |
| Boiling point |
308.5°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
140.4°C |
| Vapour Pressur |
0.000678mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
