ChemNet > CAS > 175204-69-0 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine
175204-69-0 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine
| product Name |
4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine |
| CAS No |
175204-69-0 |
| Synonyms |
4-hydrazinyl-6-(pyridin-2-yl)-1,3,5-triazin-2-amine |
| Molecular Formula |
C8H9N7 |
| Molecular Weight |
203.204 |
| InChI |
InChI=1/C8H9N7/c9-7-12-6(13-8(14-7)15-10)5-3-1-2-4-11-5/h1-4H,10H2,(H3,9,12,13,14,15) |
| Molecular Structure |
|
| Density |
1.488g/cm3 |
| Melting point |
287℃ |
| Boiling point |
550.8°C at 760 mmHg |
| Refractive index |
1.756 |
| Flash point |
286.9°C |
| Vapour Pressur |
3.52E-12mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
