ChemNet > CAS > 175205-12-6 5-(2,3-Dichlorophenyl)-1H-tetrazole
175205-12-6 5-(2,3-Dichlorophenyl)-1H-tetrazole
| product Name |
5-(2,3-Dichlorophenyl)-1H-tetrazole |
| CAS No |
175205-12-6 |
| Synonyms |
5-(2,3-Dichlorophenyl)tetrazole; 5-(2,3-dichlorophenyl)-2H-tetrazole |
| Molecular Formula |
C7H4Cl2N4 |
| Molecular Weight |
215.0395 |
| InChI |
InChI=1/C7H4Cl2N4/c8-5-3-1-2-4(6(5)9)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
| Molecular Structure |
|
| Density |
1.574g/cm3 |
| Boiling point |
408.3°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
233.1°C |
| Vapour Pressur |
7.09E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
