ChemNet > CAS > 175277-20-0 methyl 4-(1-hydroxyiminoethyl)-5-methylisoxazole-3-carboxylate
175277-20-0 methyl 4-(1-hydroxyiminoethyl)-5-methylisoxazole-3-carboxylate
| product Name |
methyl 4-(1-hydroxyiminoethyl)-5-methylisoxazole-3-carboxylate |
| CAS No |
175277-20-0 |
| Synonyms |
methyl 4-(N-hydroxyethanimidoyl)-5-methylisoxazole-3-carboxylate |
| Molecular Formula |
C8H10N2O4 |
| Molecular Weight |
198.176 |
| InChI |
InChI=1/C8H10N2O4/c1-4(9-12)6-5(2)14-10-7(6)8(11)13-3/h12H,1-3H3 |
| Molecular Structure |
|
| Density |
1.34g/cm3 |
| Melting point |
121℃ |
| Boiling point |
389.3°C at 760 mmHg |
| Refractive index |
1.549 |
| Flash point |
189.2°C |
| Vapour Pressur |
9.31E-07mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|