ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
| product Name |
6-methoxypyridine-3-carbothioamide |
| Synonyms |
6-methoxy-3-Pyridinecarbothioamide |
| Molecular Formula |
C7H8N2OS |
| Molecular Weight |
168.2162 |
| InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
| CAS Registry Number |
175277-49-3 |
| Molecular Structure |
|
| Density |
1.262g/cm3 |
| Melting point |
150℃ |
| Boiling point |
292.5°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
130.7°C |
| Vapour Pressur |
0.00183mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
