ChemNet > CAS > 175277-93-7 2-Amino-6-fluorobenzylamine
175277-93-7 2-Amino-6-fluorobenzylamine
| product Name |
2-Amino-6-fluorobenzylamine |
| CAS No |
175277-93-7 |
| Synonyms |
2-(Aminomethyl)-3-fluoroaniline |
| Molecular Formula |
C7H9FN2 |
| Molecular Weight |
140.1582 |
| InChI |
InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
| Molecular Structure |
|
| Density |
1.209g/cm3 |
| Boiling point |
265°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
117.4°C |
| Vapour Pressur |
0.00939mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
