ChemNet > CAS > 175277-95-9 1-ethyl-2-iodo-3-methylbenzene
175277-95-9 1-ethyl-2-iodo-3-methylbenzene
| product Name |
1-ethyl-2-iodo-3-methylbenzene |
| CAS No |
175277-95-9 |
| Synonyms |
2-Ethyl-6-methyliodobenzene |
| Molecular Formula |
C9H11I |
| Molecular Weight |
246.0881 |
| InChI |
InChI=1/C9H11I/c1-3-8-6-4-5-7(2)9(8)10/h4-6H,3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.532g/cm3 |
| Boiling point |
245°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
107.1°C |
| Vapour Pressur |
0.0462mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
