ChemNet > CAS > 175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
| product Name |
3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid |
| CAS No |
175278-41-8 |
| Synonyms |
(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
| Molecular Formula |
C13H14N2O4 |
| Molecular Weight |
262.2613 |
| InChI |
InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Melting point |
243℃ |
| Boiling point |
483.9°C at 760 mmHg |
| Refractive index |
1.657 |
| Flash point |
246.5°C |
| Vapour Pressur |
3.54E-10mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
