ChemNet > CAS > 1754-55-8 Ethyl 2,4,6-trimethylbenzoate
1754-55-8 Ethyl 2,4,6-trimethylbenzoate
| product Name |
Ethyl 2,4,6-trimethylbenzoate |
| CAS No |
1754-55-8 |
| Synonyms |
Ethyl mesitoate~2,4,6-Trimethylbenzoic acid ethyl ester |
| Molecular Formula |
C12H16O2 |
| Molecular Weight |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-5-14-12(13)11-9(3)6-8(2)7-10(11)4/h6-7H,5H2,1-4H3 |
| EINECS |
217-143-1 |
| Molecular Structure |
|
| Density |
0.997g/cm3 |
| Boiling point |
257.8°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
113.8°C |
| Vapour Pressur |
0.0143mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
