ChemNet > CAS > 17598-02-6 Precocene I
17598-02-6 Precocene I
| product Name |
Precocene I |
| CAS No |
17598-02-6 |
| Synonyms |
7-Methoxy-2,2-dimethylchromene; 7-methoxy-2,2-dimethyl-2H-chromene |
| Molecular Formula |
C12H14O2 |
| Molecular Weight |
190.2384 |
| InChI |
InChI=1/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
| EINECS |
241-566-0 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Boiling point |
292.7°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
105.1°C |
| Vapour Pressur |
0.00315mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
