ChemNet > CAS > 17609-48-2 H-D-Phg-OEt . HCl
17609-48-2 H-D-Phg-OEt . HCl
| product Name |
H-D-Phg-OEt . HCl |
| CAS No |
17609-48-2 |
| Synonyms |
D-(-)-alpha-Phenylglycine ethyl ester hydrochloride; (R)-(-)-alpha-Aminophenylacetic acid ethyl ester hydrochloride~H-D-Phg-OEt.HCl; ethyl (2-aminophenyl)acetate hydrochloride; ethyl (2R)-amino(phenyl)ethanoate |
| Molecular Formula |
C10H13NO2 |
| Molecular Weight |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9H,2,11H2,1H3/t9-/m1/s1 |
| EINECS |
241-581-2 |
| Molecular Structure |
|
| Density |
1.098g/cm3 |
| Boiling point |
257°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
120°C |
| Vapour Pressur |
0.0149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
