ChemNet > CAS > 17614-74-3 4-Methyl-2-nitrophenyl isothiocyanate
17614-74-3 4-Methyl-2-nitrophenyl isothiocyanate
| product Name |
4-Methyl-2-nitrophenyl isothiocyanate |
| CAS No |
17614-74-3 |
| Synonyms |
1-isothiocyanato-4-methyl-2-nitrobenzene |
| Molecular Formula |
C8H6N2O2S |
| Molecular Weight |
194.2104 |
| InChI |
InChI=1/C8H6N2O2S/c1-6-2-3-7(9-5-13)8(4-6)10(11)12/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.28g/cm3 |
| Melting point |
61-65℃ |
| Boiling point |
347.3°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
163.8°C |
| Vapour Pressur |
0.000109mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
