ChemNet > CAS > 17624-26-9 N-2-(2-Pyridylethyl)phthalimide
17624-26-9 N-2-(2-Pyridylethyl)phthalimide
| product Name |
N-2-(2-Pyridylethyl)phthalimide |
| CAS No |
17624-26-9 |
| Synonyms |
2-[2-(pyridin-2-yl)ethyl]-1H-isoindole-1,3(2H)-dione |
| Molecular Formula |
C15H12N2O2 |
| Molecular Weight |
252.268 |
| InChI |
InChI=1/C15H12N2O2/c18-14-12-6-1-2-7-13(12)15(19)17(14)10-8-11-5-3-4-9-16-11/h1-7,9H,8,10H2 |
| Molecular Structure |
|
| Density |
1.299g/cm3 |
| Boiling point |
419.2°C at 760 mmHg |
| Refractive index |
1.635 |
| Flash point |
207.3°C |
| Vapour Pressur |
3.09E-07mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|