ChemNet > CAS > 17687-72-8 9-Octyl-9-heptadecanol
17687-72-8 9-Octyl-9-heptadecanol
| product Name |
9-Octyl-9-heptadecanol |
| CAS No |
17687-72-8 |
| Synonyms |
Tri-n-octylmethanol; 9-octylheptadecane-9-ol; 6-bromo-1H-indole-3-carbaldehyde |
| Molecular Formula |
C9H6BrNO |
| Molecular Weight |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-7-1-2-8-6(5-12)4-11-9(8)3-7/h1-5,11H |
| EINECS |
241-673-2 |
| Molecular Structure |
|
| Density |
1.727g/cm3 |
| Boiling point |
395.6°C at 760 mmHg |
| Refractive index |
1.752 |
| Flash point |
193°C |
| Vapour Pressur |
1.82E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
