ChemNet > CAS > 17722-17-7 4'-chloro-2-cyanoacetanilide
17722-17-7 4'-chloro-2-cyanoacetanilide
| product Name |
4'-chloro-2-cyanoacetanilide |
| CAS No |
17722-17-7 |
| Synonyms |
4-Chloro-2-cyanoacetanilide; N-(4-Chlorophenyl)cyanoacetamide; N-(4-chlorophenyl)-2-cyanoacetamide |
| Molecular Formula |
C9H7ClN2O |
| Molecular Weight |
194.6177 |
| InChI |
InChI=1/C9H7ClN2O/c10-7-1-3-8(4-2-7)12-9(13)5-6-11/h1-4H,5H2,(H,12,13) |
| EINECS |
241-720-7 |
| Molecular Structure |
|
| Density |
1.348g/cm3 |
| Melting point |
207-209℃ |
| Boiling point |
427.4°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
212.3°C |
| Vapour Pressur |
1.64E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
