ChemNet > CAS > 177756-62-6 3-Fluoro-4-methylbenzaldehyde
177756-62-6 3-Fluoro-4-methylbenzaldehyde
| product Name |
3-Fluoro-4-methylbenzaldehyde |
| CAS No |
177756-62-6 |
| Synonyms |
3-Fluoro-p-tolualdehyde |
| Molecular Formula |
C8H7FO |
| Molecular Weight |
138.139 |
| InChI |
InChI=1/C8H7FO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Boiling point |
198.3°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
80.1°C |
| Vapour Pressur |
0.362mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
