ChemNet > CAS > 17784-47-3 Acridine hydrochloride
17784-47-3 Acridine hydrochloride
| product Name |
Acridine hydrochloride |
| CAS No |
17784-47-3 |
| Molecular Formula |
C13H10ClN |
| Molecular Weight |
215.6782 |
| InChI |
InChI=1/C13H9N.ClH/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-9H;1H |
| EINECS |
241-762-6 |
| Molecular Structure |
|
| Melting point |
250-255℃ |
| Boiling point |
346.7°C at 760 mmHg |
| Flash point |
153.8°C |
| Vapour Pressur |
0.000113mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
