ChemNet > CAS > 177842-14-7 4-(difluoromethoxy)benzylamine
177842-14-7 4-(difluoromethoxy)benzylamine
| product Name |
4-(difluoromethoxy)benzylamine |
| CAS No |
177842-14-7 |
| Synonyms |
1-[4-(difluoromethoxy)phenyl]methanamine |
| Molecular Formula |
C8H9F2NO |
| Molecular Weight |
173.16 |
| InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,8H,5,11H2 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Boiling point |
227.3°C at 760 mmHg |
| Refractive index |
1.487 |
| Flash point |
91.3°C |
| Vapour Pressur |
0.0781mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
