ChemNet > CAS > 17789-14-9 2-(3-bromophenyl)-1,3-dioxolane
17789-14-9 2-(3-bromophenyl)-1,3-dioxolane
| product Name |
2-(3-bromophenyl)-1,3-dioxolane |
| CAS No |
17789-14-9 |
| Synonyms |
3-Bromobenzaldehyde ethylene acetal; 2-(3-bromophenyl)-1,3-dioxane |
| Molecular Formula |
C10H11BrO2 |
| Molecular Weight |
243.0971 |
| InChI |
InChI=1/C10H11BrO2/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1,3-4,7,10H,2,5-6H2 |
| EINECS |
241-766-8 |
| Molecular Structure |
|
| Density |
1.439g/cm3 |
| Boiling point |
306.372°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
138.473°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
