ChemNet > CAS > 1779-10-8 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid
1779-10-8 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid
| product Name |
1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid |
| CAS No |
1779-10-8 |
| Synonyms |
1,6-Dibromo-2-naphthol-3-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylate |
| Molecular Formula |
C11H5Br2O3 |
| Molecular Weight |
344.9641 |
| InChI |
InChI=1/C11H6Br2O3/c12-6-1-2-7-5(3-6)4-8(11(15)16)10(14)9(7)13/h1-4,14H,(H,15,16)/p-1 |
| EINECS |
217-214-7 |
| Molecular Structure |
|
| Melting point |
251-253℃ |
| Boiling point |
427.6°C at 760 mmHg |
| Flash point |
212.4°C |
| Vapour Pressur |
4.49E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
