ChemNet > CAS > 178305-99-2 2-Fluorobiphenyl-4-boronic acid
178305-99-2 2-Fluorobiphenyl-4-boronic acid
| product Name |
2-Fluorobiphenyl-4-boronic acid |
| CAS No |
178305-99-2 |
| Synonyms |
3-Fluoro-4-phenylbenzeneboronic acid; 2-Fluoro-4-biphenylylboronic acid; (2-fluorobiphenyl-4-yl)boronic acid; (3-fluorobiphenyl-4-yl)boronic acid |
| Molecular Formula |
C12H10BFO2 |
| Molecular Weight |
216.016 |
| InChI |
InChI=1/C12H10BFO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H |
| Molecular Structure |
|
| Density |
1.257g/cm3 |
| Melting point |
243-248℃ |
| Boiling point |
384.155°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
186.131°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
|
