ChemNet > CAS > 17846-15-0 adamantane-1-carbohydrazide
17846-15-0 adamantane-1-carbohydrazide
| product Name |
adamantane-1-carbohydrazide |
| CAS No |
17846-15-0 |
| Synonyms |
tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
| Molecular Formula |
C11H18N2O |
| Molecular Weight |
194.2734 |
| InChI |
InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
| Molecular Structure |
|
| Density |
1.203g/cm3 |
| Melting point |
157℃ |
| Boiling point |
370.8°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
178°C |
| Vapour Pressur |
1.08E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
