ChemNet > CAS > 1785-61-1 m-Diethynylbenzene
1785-61-1 m-Diethynylbenzene
| product Name |
m-Diethynylbenzene |
| CAS No |
1785-61-1 |
| Synonyms |
1,3-Diethynylbenzene |
| Molecular Formula |
C10H6 |
| Molecular Weight |
126.1546 |
| InChI |
InChI=1/C10H6/c1-3-9-6-5-7-10(4-2)8-9/h1-2,5-8H |
| Molecular Structure |
|
| Density |
1g/cm3 |
| Boiling point |
206.9°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
66.5°C |
| Vapour Pressur |
0.332mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
