ChemNet > CAS > 179923-32-1 2,3,4,5-Tetrafluorobenzeneboronic acid
179923-32-1 2,3,4,5-Tetrafluorobenzeneboronic acid
| product Name |
2,3,4,5-Tetrafluorobenzeneboronic acid |
| CAS No |
179923-32-1 |
| Synonyms |
2,3,4,5-Tetrafluorophenylboronic acid |
| Molecular Formula |
C6H3BF4O2 |
| Molecular Weight |
193.8914 |
| InChI |
InChI=1/C6H3BF4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,12-13H |
| Molecular Structure |
|
| Density |
1.53g/cm3 |
| Boiling point |
257.6°C at 760 mmHg |
| Refractive index |
1.446 |
| Flash point |
109.6°C |
| Vapour Pressur |
0.00737mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
