ChemNet > CAS > 1801-72-5 1,3-Diallylurea
1801-72-5 1,3-Diallylurea
| product Name |
1,3-Diallylurea |
| CAS No |
1801-72-5 |
| Synonyms |
NSC 102722; DAU; N,N'-Diallylurea; Urea, 1,3-diallyl- (8CI); Urea, N,N'-di-2-propenyl- (9CI); 1,3-diprop-2-en-1-ylurea |
| Molecular Formula |
C7H12N2O |
| Molecular Weight |
140.183 |
| InChI |
InChI=1/C7H12N2O/c1-3-5-8-7(10)9-6-4-2/h3-4H,1-2,5-6H2,(H2,8,9,10) |
| EINECS |
217-291-7 |
| Molecular Structure |
|
| Density |
0.94g/cm3 |
| Melting point |
90-93℃ |
| Boiling point |
285.3°C at 760 mmHg |
| Refractive index |
1.464 |
| Flash point |
129.6°C |
| Vapour Pressur |
0.00282mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
