ChemNet > CAS > 18066-68-7 Ethyl 3,4-dimethoxyphenylacetate
18066-68-7 Ethyl 3,4-dimethoxyphenylacetate
| product Name |
Ethyl 3,4-dimethoxyphenylacetate |
| CAS No |
18066-68-7 |
| Synonyms |
3,4-Dimethoxyphenylacetic acid ethyl ester |
| Molecular Formula |
C12H16O4 |
| Molecular Weight |
224.253 |
| InChI |
InChI=1/C12H16O4/c1-4-16-12(13)8-9-5-6-10(14-2)11(7-9)15-3/h5-7H,4,8H2,1-3H3 |
| EINECS |
241-974-9 |
| Molecular Structure |
|
| Density |
1.084g/cm3 |
| Boiling point |
302°C at 760 mmHg |
| Refractive index |
1.494 |
| Flash point |
129.3°C |
| Vapour Pressur |
0.00102mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
