ChemNet > CAS > 18190-44-8 N-(2-Hydroxyethyl)succinimide
18190-44-8 N-(2-Hydroxyethyl)succinimide
| product Name |
N-(2-Hydroxyethyl)succinimide |
| CAS No |
18190-44-8 |
| Synonyms |
1-(2-hydroxyethyl)pyrrolidine-2,5-dione |
| Molecular Formula |
C6H9NO3 |
| Molecular Weight |
143.1406 |
| InChI |
InChI=1/C6H9NO3/c8-4-3-7-5(9)1-2-6(7)10/h8H,1-4H2 |
| Molecular Structure |
|
| Density |
1.327g/cm3 |
| Melting point |
57-61℃ |
| Boiling point |
351.8°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
166.6°C |
| Vapour Pressur |
2.36E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
