ChemNet > CAS > 18217-00-0 1-(2-Chloroethyl)-4-methoxybenzene
18217-00-0 1-(2-Chloroethyl)-4-methoxybenzene
| product Name |
1-(2-Chloroethyl)-4-methoxybenzene |
| CAS No |
18217-00-0 |
| Synonyms |
4-Methoxyphenethyl chloride; 4-(2-chloroethyl)phenyl methyl ether; 2-(4)-Methoxyphenylethylchloride; 4-(2-Chloroethyl)anisole |
| Molecular Formula |
C9H11ClO |
| Molecular Weight |
170.636 |
| InChI |
InChI=1/C9H11ClO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7H2,1H3 |
| EINECS |
242-099-5 |
| Molecular Structure |
|
| Density |
1.082g/cm3 |
| Boiling point |
249.1°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
108.7°C |
| Vapour Pressur |
0.0368mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
