ChemNet > CAS > 1823-14-9 5-Phenyl-1-pentyne
1823-14-9 5-Phenyl-1-pentyne
| product Name |
5-Phenyl-1-pentyne |
| CAS No |
1823-14-9 |
| Synonyms |
Pent-4-ynylbenzene; pent-4-yn-1-ylbenzene; (2S)-2-hydroxy-3-phenylpropanoic acid |
| Molecular Formula |
C9H10O3 |
| Molecular Weight |
166.1739 |
| InChI |
InChI=1/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 |
| EINECS |
217-352-8 |
| Molecular Structure |
|
| Density |
1.265g/cm3 |
| Boiling point |
331.6°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
168.5°C |
| Vapour Pressur |
6.17E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
