ChemNet > CAS > 1823-44-5 2-(2-Thiazolylazo)-p-cresol
1823-44-5 2-(2-Thiazolylazo)-p-cresol
| product Name |
2-(2-Thiazolylazo)-p-cresol |
| CAS No |
1823-44-5 |
| Synonyms |
TAC; 4-Methyl-2-(2-thiazolylazo)-phenol; 4-methyl-6-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,4-dien-1-one; (6E)-4-methyl-6-[2-(1,3-thiazol-2-yl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
| Molecular Formula |
C10H9N3OS |
| Molecular Weight |
219.263 |
| InChI |
InChI=1/C10H9N3OS/c1-7-2-3-9(14)8(6-7)12-13-10-11-4-5-15-10/h2-6H,1H3,(H,11,13)/b12-8+ |
| Molecular Structure |
|
| Density |
1.357g/cm3 |
| Melting point |
127-130℃ |
| Boiling point |
464.649°C at 760 mmHg |
| Refractive index |
1.681 |
| Flash point |
234.812°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
