ChemNet > CAS > 1825-00-9 Methyl beta-L-arabinopyranoside
1825-00-9 Methyl beta-L-arabinopyranoside
| product Name |
Methyl beta-L-arabinopyranoside |
| CAS No |
1825-00-9 |
| Synonyms |
(2S,4R,5S)-2-methoxytetrahydropyran-3,4,5-triol |
| Molecular Formula |
C6H12O5 |
| Molecular Weight |
164.1565 |
| InChI |
InChI=1/C6H12O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3-9H,2H2,1H3/t3-,4+,5?,6-/m0/s1 |
| EINECS |
217-362-2 |
| Molecular Structure |
|
| Density |
1.4g/cm3 |
| Boiling point |
314°C at 760 mmHg |
| Refractive index |
1.522 |
| Flash point |
143.7°C |
| Vapour Pressur |
4.16E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
