ChemNet > CAS > 1829-28-3 Ethyl 2-iodobenzoate
1829-28-3 Ethyl 2-iodobenzoate
| product Name |
Ethyl 2-iodobenzoate |
| CAS No |
1829-28-3 |
| Synonyms |
Ethyl 2-iodobenzoate, (2-Iodobenzoic acid ethyl ester); 2-Iodobenzoic acid ethyl ester |
| Molecular Formula |
C9H9IO2 |
| Molecular Weight |
276.071 |
| InChI |
InChI=1/C9H9IO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.664g/cm3 |
| Boiling point |
275.6°C at 760 mmHg |
| Refractive index |
1.584 |
| Flash point |
120.5°C |
| Vapour Pressur |
0.00505mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
