ChemNet > CAS > 1835-11-6 4'-Benzyloxy-3'-methoxyacetophenone
1835-11-6 4'-Benzyloxy-3'-methoxyacetophenone
| product Name |
4'-Benzyloxy-3'-methoxyacetophenone |
| CAS No |
1835-11-6 |
| Synonyms |
4-Benzyloxy-3-methoxyacetophenone; 1-[4-(benzyloxy)-3-methoxyphenyl]ethanone; 1-[3-(benzyloxy)-4-methoxyphenyl]ethanone |
| Molecular Formula |
C16H16O3 |
| Molecular Weight |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-12(17)14-8-9-15(18-2)16(10-14)19-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.115g/cm3 |
| Boiling point |
396.5°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
185.2°C |
| Vapour Pressur |
1.7E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
