ChemNet > CAS > 18536-91-9 Dodecyltriethoxysilane
18536-91-9 Dodecyltriethoxysilane
| product Name |
Dodecyltriethoxysilane |
| CAS No |
18536-91-9 |
| Synonyms |
n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
| Molecular Formula |
C16H30O2 |
| Molecular Weight |
254.4082 |
| InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
| EINECS |
242-409-9 |
| Molecular Structure |
|
| Density |
0.886g/cm3 |
| Boiling point |
353.1°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
132.5°C |
| Vapour Pressur |
3.67E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
