ChemNet > CAS > 18591-82-7 6-Methylpyridazin-3-amine
18591-82-7 6-Methylpyridazin-3-amine
| product Name |
6-Methylpyridazin-3-amine |
| CAS No |
18591-82-7 |
| Synonyms |
3-Amino-6-Methylpyridazine |
| Molecular Formula |
C5H7N3 |
| Molecular Weight |
109.13068 |
| InChI |
InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
| EINECS |
242-430-3 |
| Molecular Structure |
|
| Density |
2.204g/cm3 |
| Melting point |
230℃ |
| Boiling point |
399.6°C at 760 mmHg |
| Refractive index |
1.719 |
| Flash point |
195.5°C |
| Vapour Pressur |
1.35E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
