ChemNet > CAS > 18640-58-9 4'-Bromo-3'-nitroacetophenone
18640-58-9 4'-Bromo-3'-nitroacetophenone
| product Name |
4'-Bromo-3'-nitroacetophenone |
| CAS No |
18640-58-9 |
| Synonyms |
4-Bromo-3-nitroacetophenone; 4'-Bromo-3'-nitroacetophenone; 1-(4-Bromo-3-nitrophenyl)-ethan-1-one; 1-(4-bromo-3-nitrophenyl)ethanone |
| Molecular Formula |
C8H6BrNO3 |
| Molecular Weight |
244.0421 |
| InChI |
InChI=1/C8H6BrNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| EINECS |
242-469-6 |
| Molecular Structure |
|
| Density |
1.637g/cm3 |
| Melting point |
118-120℃ |
| Boiling point |
275.4°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
120.4°C |
| Vapour Pressur |
0.00511mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
