ChemNet > CAS > 18711-13-2 4,7-Dichloroisatin
18711-13-2 4,7-Dichloroisatin
| product Name |
4,7-Dichloroisatin |
| CAS No |
18711-13-2 |
| Synonyms |
4,7-dichloro-1H-indole-2,3-dione; 4,7-Dichloroindoline-2,3-dione |
| Molecular Formula |
C8H3Cl2NO2 |
| Molecular Weight |
216.0209 |
| InChI |
InChI=1/C8H3Cl2NO2/c9-3-1-2-4(10)6-5(3)7(12)8(13)11-6/h1-2H,(H,11,12,13) |
| Molecular Structure |
|
| Density |
1.643g/cm3 |
| Melting point |
251-254℃ |
| Refractive index |
1.637 |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
