ChemNet > CAS > 18729-48-1 3-Methylcyclopentanol, mixture of isomers
18729-48-1 3-Methylcyclopentanol, mixture of isomers
| product Name |
3-Methylcyclopentanol, mixture of isomers |
| CAS No |
18729-48-1 |
| Synonyms |
1-Methyl-3-cyclopentanol; 3-methylcyclopentanol; (1S,3S)-3-methylcyclopentanol |
| Molecular Formula |
C6H12O |
| Molecular Weight |
100.1589 |
| InChI |
InChI=1/C6H12O/c1-5-2-3-6(7)4-5/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| EINECS |
242-540-1 |
| Molecular Structure |
|
| Density |
0.947g/cm3 |
| Boiling point |
146.9°C at 760 mmHg |
| Refractive index |
1.467 |
| Flash point |
55°C |
| Vapour Pressur |
1.77mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
|
| MSDS |
Material Safety Data Sheet
|
|
