ChemNet > CAS > 1875-48-5 N-Aminophthalimide
1875-48-5 N-Aminophthalimide
| product Name |
N-Aminophthalimide |
| CAS No |
1875-48-5 |
| Synonyms |
Aminophthalimidetech; 2-amino-1H-isoindole-1,3(2H)-dione |
| Molecular Formula |
C8H6N2O2 |
| Molecular Weight |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,9H2 |
| EINECS |
217-505-9 |
| Molecular Structure |
|
| Density |
1.472g/cm3 |
| Melting point |
200-202℃ |
| Boiling point |
348.6°C at 760 mmHg |
| Refractive index |
1.67 |
| Flash point |
164.6°C |
| Vapour Pressur |
4.97E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
