ChemNet > CAS > 1875-89-4 3-Methylphenethyl alcohol
1875-89-4 3-Methylphenethyl alcohol
| product Name |
3-Methylphenethyl alcohol |
| CAS No |
1875-89-4 |
| Synonyms |
2-m-tolylethanol; 2-(3-Methylphenyl)ethanol; 2-(4-methylphenyl)ethanol; M-METHYL PHENYL ETHANOL; m-Methylphenethyl alcohol |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-8-2-4-9(5-3-8)6-7-10/h2-5,10H,6-7H2,1H3 |
| EINECS |
217-508-5 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Boiling point |
243.5°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
107.2°C |
| Vapour Pressur |
0.0172mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
