ChemNet > CAS > 187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
| product Name |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
| CAS No |
187657-92-7 |
| Synonyms |
[2,4-bis(methylsulfonyl)phenyl]hydrazine; 1-(1-benzofuran-3-yl)-2-bromoethanone |
| Molecular Formula |
C10H7BrO2 |
| Molecular Weight |
239.0654 |
| InChI |
InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
| EINECS |
260-718-7 |
| Molecular Structure |
|
| Density |
1.582g/cm3 |
| Melting point |
136℃ |
| Boiling point |
306.8°C at 760 mmHg |
| Refractive index |
1.636 |
| Flash point |
139.3°C |
| Vapour Pressur |
0.000755mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
