ChemNet > CAS > 1892-57-5 N-(3-dimethylaminopropyl)-N'-ethyl-carbodiimide
1892-57-5 N-(3-dimethylaminopropyl)-N'-ethyl-carbodiimide
| product Name |
N-(3-dimethylaminopropyl)-N'-ethyl-carbodiimide |
| Synonyms |
1-(3-dimethylaminopropyl)-N-ethylcarbodiimide; 1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide |
| Molecular Formula |
C8H17N3 |
| Molecular Weight |
155.2407 |
| InChI |
InChI=1/C8H17N3/c1-4-9-8-10-6-5-7-11(2)3/h4-7H2,1-3H3 |
| CAS Registry Number |
1892-57-5 |
| EINECS |
217-579-2 |
| Molecular Structure |
|
| Density |
0.86g/cm3 |
| Boiling point |
197.7°C at 760 mmHg |
| Refractive index |
1.459 |
| Flash point |
73.4°C |
| Vapour Pressur |
0.373mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
