ChemNet > CAS > 189807-20-3 2,3,6-trifluorobenzoyl chloride
189807-20-3 2,3,6-trifluorobenzoyl chloride
| product Name |
2,3,6-trifluorobenzoyl chloride |
| CAS No |
189807-20-3 |
| Synonyms |
Trifluorobenzoylchloride |
| Molecular Formula |
C7H2ClF3O |
| Molecular Weight |
194.5384 |
| InChI |
InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
| Molecular Structure |
|
| Density |
1.514g/cm3 |
| Boiling point |
180.1°C at 760 mmHg |
| Refractive index |
1.479 |
| Flash point |
59°C |
| Vapour Pressur |
0.913mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
