ChemNet > CAS > 19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
| product Name |
Ethyl 4-hydroxy-3-nitrobenzoate |
| CAS No |
19013-10-6 |
| Synonyms |
4-Hydroxy-3-nitrobenzoic acid ethyl ester |
| Molecular Formula |
C9H9NO5 |
| Molecular Weight |
211.1715 |
| InChI |
InChI=1/C9H9NO5/c1-2-15-9(12)6-3-4-8(11)7(5-6)10(13)14/h3-5,11H,2H2,1H3 |
| EINECS |
242-751-9 |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Boiling point |
323.5°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
149.5°C |
| Vapour Pressur |
0.000138mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
